C18H22N4O10S — CID 90758217
4-(2,5-dioxopyrrol-1-yl)butanoic acid;methyl carbamate;thionitroso 4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 90758217) has the molecular formula C18H22N4O10S and a molecular weight of 486.46 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butanoic acid;methyl carbamate;thionitroso 4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)butanoic acid;methyl carbamate;thionitroso 4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 90758217 |
| Molecular Formula | C18H22N4O10S |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)butanoic acid;methyl carbamate;thionitroso 4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | COC(N)=O.O=C(CCCN1C(=O)C=CC1=O)ON=S.O=C(O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H8N2O4S.C8H9NO4.C2H5NO2/c11-6-3-4-7(12)10(6)5-1-2-8(13)14-9-15;10-6-3-4-7(11)9(6)5-1-2-8(12)13;1-5-2(3)4/h3-4H,1-2,5H2;3-4H,1-2,5H2,(H,12,13);1H3,(H2,3,4) |
| InChIKey | MFKKRFFALJRWHG-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 203.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|