C10H13N3O6S — CID 90851952
methyl carbamate;thionitroso 4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 90851952) has the molecular formula C10H13N3O6S and a molecular weight of 303.30 g/mol. Its IUPAC name is methyl carbamate;thionitroso 4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | methyl carbamate;thionitroso 4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 90851952 |
| Molecular Formula | C10H13N3O6S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | methyl carbamate;thionitroso 4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | COC(N)=O.O=C(CCCN1C(=O)C=CC1=O)ON=S |
| InChI | InChI=1S/C8H8N2O4S.C2H5NO2/c11-6-3-4-7(12)10(6)5-1-2-8(13)14-9-15;1-5-2(3)4/h3-4H,1-2,5H2;1H3,(H2,3,4) |
| InChIKey | MIJXOJPLNQRRSB-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|