C17H24N2O7 — CID 158709279
methanol;methyl 4-(2,5-dioxopyrrol-1-yl)butanoate;1-propylpyrrole-2,5-dione (PubChem CID 158709279) has the molecular formula C17H24N2O7 and a molecular weight of 368.39 g/mol. Its IUPAC name is methanol;methyl 4-(2,5-dioxopyrrol-1-yl)butanoate;1-propylpyrrole-2,5-dione.
| Compound Name | methanol;methyl 4-(2,5-dioxopyrrol-1-yl)butanoate;1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 158709279 |
| Molecular Formula | C17H24N2O7 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | methanol;methyl 4-(2,5-dioxopyrrol-1-yl)butanoate;1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C=CC1=O.CO.COC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H11NO4.C7H9NO2.CH4O/c1-14-9(13)3-2-6-10-7(11)4-5-8(10)12;1-2-5-8-6(9)3-4-7(8)10;1-2/h4-5H,2-3,6H2,1H3;3-4H,2,5H2,1H3;2H,1H3 |
| InChIKey | IINATROGUALTLI-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|