C16H16N2O7 — CID 87396636
4-(2,5-dioxopyrrol-1-yl)butanoyl 4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 87396636) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butanoyl 4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)butanoyl 4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 87396636 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)butanoyl 4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)C=CC1=O)OC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H16N2O7/c19-11-5-6-12(20)17(11)9-1-3-15(23)25-16(24)4-2-10-18-13(21)7-8-14(18)22/h5-8H,1-4,9-10H2 |
| InChIKey | RNFCJVPYTFGDBC-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|