C20H24N2O7 — CID 54041172
6-(2,5-dioxopyrrol-1-yl)hexanoyl 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 54041172) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexanoyl 6-(2,5-dioxopyrrol-1-yl)hexanoate.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexanoyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
|---|---|
| PubChem CID | 54041172 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexanoyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)OC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H24N2O7/c23-15-9-10-16(24)21(15)13-5-1-3-7-19(27)29-20(28)8-4-2-6-14-22-17(25)11-12-18(22)26/h9-12H,1-8,13-14H2 |
| InChIKey | LMLMLCNXADWFRX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|