C26H36N2O8 — CID 22084357
6-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]hexyl 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 22084357) has the molecular formula C26H36N2O8 and a molecular weight of 504.58 g/mol. Its IUPAC name is 6-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]hexyl 6-(2,5-dioxopyrrol-1-yl)hexanoate.
| Compound Name | 6-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]hexyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
|---|---|
| PubChem CID | 22084357 |
| Molecular Formula | C26H36N2O8 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 6-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]hexyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)OCCCCCCOC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C26H36N2O8/c29-21-13-14-22(30)27(21)17-7-3-5-11-25(33)35-19-9-1-2-10-20-36-26(34)12-6-4-8-18-28-23(31)15-16-24(28)32/h13-16H,1-12,17-20H2 |
| InChIKey | PXRWDZSALJRCSC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|