About 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate
10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate (PubChem CID 20681110) has the molecular formula C31H46N2O7
and a molecular weight of 558.72 g/mol. Its IUPAC name is 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate.
Molecular Properties
| Compound Name | 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate |
| PubChem CID | 20681110 |
| Molecular Formula | C31H46N2O7 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate |
| SMILES | C=C1C=CC(=O)N1CCCCCC(=O)OCCCCCCCCCCOC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C31H46N2O7/c1-26-18-19-27(34)32(26)22-12-8-10-16-30(37)39-24-14-6-4-2-3-5-7-15-25-40-31(38)17-11-9-13-23-33-28(35)20-21-29(33)36/h18-21H,1-17,22-25H2 |
| InChIKey | DBFJPSKMVJTJCE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate?
The IUPAC name of 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate (CID 20681110) is 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate.
What is the SMILES notation for 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate?
The canonical SMILES for 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate is C=C1C=CC(=O)N1CCCCCC(=O)OCCCCCCCCCCOC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate?
The InChIKey is DBFJPSKMVJTJCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H46N2O7/c1-26-18-19-27(34)32(26)22-12-8-10-16-30(37)39-24-14-6-4-2-3-5-7-15-25-40-31(38)17-11-9-13-23-33-28(35)20-21-29(33)36/h18-21H,1-17,22-25H2.
What are the key properties of 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate?
10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate has a molecular weight of 558.72 g/mol, XLogP of 5.15, 23 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]decyl 6-(2-methylidene-5-oxopyrrol-1-yl)hexanoate is sourced from PubChem (CID 20681110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).