C18H22N4O10 — CID 130269261
4-[3-aminopropanoyl-[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]amino]-4-oxobutanoic acid (PubChem CID 130269261) has the molecular formula C18H22N4O10 and a molecular weight of 454.39 g/mol. Its IUPAC name is 4-[3-aminopropanoyl-[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]amino]-4-oxobutanoic acid.
| Compound Name | 4-[3-aminopropanoyl-[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 130269261 |
| Molecular Formula | C18H22N4O10 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 4-[3-aminopropanoyl-[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]amino]-4-oxobutanoic acid |
| SMILES | NCCC(=O)N(C(=O)CCC(=O)O)N(C(=O)CCC(=O)O)C(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H22N4O10/c19-9-7-15(27)21(13(25)3-5-17(29)30)22(14(26)4-6-18(31)32)16(28)8-10-20-11(23)1-2-12(20)24/h1-2H,3-10,19H2,(H,29,30)(H,31,32) |
| InChIKey | JBBNBIMOVAVUFP-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 212.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|