C22H24N4O11 — CID 130268644
4-[[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(5-oxo-2H-pyrrol-1-yl)propanoyl]amino]-4-oxobutanoic acid (PubChem CID 130268644) has the molecular formula C22H24N4O11 and a molecular weight of 520.45 g/mol. Its IUPAC name is 4-[[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(5-oxo-2H-pyrrol-1-yl)propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(5-oxo-2H-pyrrol-1-yl)propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 130268644 |
| Molecular Formula | C22H24N4O11 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 4-[[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(5-oxo-2H-pyrrol-1-yl)propanoyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(C(=O)CCN1CC=CC1=O)N(C(=O)CCC(=O)O)C(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H24N4O11/c27-14-2-1-11-23(14)12-9-19(32)25(17(30)5-7-21(34)35)26(18(31)6-8-22(36)37)20(33)10-13-24-15(28)3-4-16(24)29/h1-4H,5-13H2,(H,34,35)(H,36,37) |
| InChIKey | CWHPPAFTKWPPFX-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 207.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|