C20H22N4O10 — CID 118483293
3-[[2-carboxyethyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid (PubChem CID 118483293) has the molecular formula C20H22N4O10 and a molecular weight of 478.41 g/mol. Its IUPAC name is 3-[[2-carboxyethyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid.
| Compound Name | 3-[[2-carboxyethyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 118483293 |
| Molecular Formula | C20H22N4O10 |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-[[2-carboxyethyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)CCN1C(=O)C=CC1=O)N(CCC(=O)O)C(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H22N4O10/c25-13-1-2-14(26)21(13)9-5-17(29)23(11-7-19(31)32)24(12-8-20(33)34)18(30)6-10-22-15(27)3-4-16(22)28/h1-4H,5-12H2,(H,31,32)(H,33,34) |
| InChIKey | QMZVYCRWEMBZTQ-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 189.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|