C12H10N2O6 — CID 67597575
3-(2,5-dioxopyrrol-1-yl)-2-[(2,5-dioxopyrrol-1-yl)methyl]propanoic acid (PubChem CID 67597575) has the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-2-[(2,5-dioxopyrrol-1-yl)methyl]propanoic acid.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-2-[(2,5-dioxopyrrol-1-yl)methyl]propanoic acid |
|---|---|
| PubChem CID | 67597575 |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-2-[(2,5-dioxopyrrol-1-yl)methyl]propanoic acid |
| SMILES | O=C(O)C(CN1C(=O)C=CC1=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H10N2O6/c15-8-1-2-9(16)13(8)5-7(12(19)20)6-14-10(17)3-4-11(14)18/h1-4,7H,5-6H2,(H,19,20) |
| InChIKey | BEZHWIGLLCUERO-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|