C20H26N4O10 — CID 138644613
3-[[2-carboxyethyl-[3-[[(Z)-3-hydroxyprop-2-enoyl]-methylamino]propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid (PubChem CID 138644613) has the molecular formula C20H26N4O10 and a molecular weight of 482.45 g/mol. Its IUPAC name is 3-[[2-carboxyethyl-[3-[[(Z)-3-hydroxyprop-2-enoyl]-methylamino]propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid.
| Compound Name | 3-[[2-carboxyethyl-[3-[[(Z)-3-hydroxyprop-2-enoyl]-methylamino]propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 138644613 |
| Molecular Formula | C20H26N4O10 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 3-[[2-carboxyethyl-[3-[[(Z)-3-hydroxyprop-2-enoyl]-methylamino]propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)N(CCC(=O)O)N(CCC(=O)O)C(=O)CCN1C(=O)C=CC1=O)C(=O)/C=C\O |
| InChI | InChI=1S/C20H26N4O10/c1-21(14(26)8-13-25)9-4-17(29)23(11-6-19(31)32)24(12-7-20(33)34)18(30)5-10-22-15(27)2-3-16(22)28/h2-3,8,13,25H,4-7,9-12H2,1H3,(H,31,32)(H,33,34)/b13-8- |
| InChIKey | LOBDMAHGCXJYDW-JYRVWZFOSA-N |
| XLogP | -1.26 |
| TPSA | 193.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|