C21H26N4O10 — CID 167284197
3-[[2-carboxyethyl-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid (PubChem CID 167284197) has the molecular formula C21H26N4O10 and a molecular weight of 494.46 g/mol. Its IUPAC name is 3-[[2-carboxyethyl-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid.
| Compound Name | 3-[[2-carboxyethyl-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 167284197 |
| Molecular Formula | C21H26N4O10 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 3-[[2-carboxyethyl-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)N(CCC(=O)O)N(CCC(=O)O)C(=O)CCN1C(=O)C=CC1=O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C21H26N4O10/c1-22(15(27)3-2-14-26)10-6-18(30)24(12-8-20(32)33)25(13-9-21(34)35)19(31)7-11-23-16(28)4-5-17(23)29/h2-5,14H,6-13H2,1H3,(H,32,33)(H,34,35)/b3-2- |
| InChIKey | MTFBTTANXHUQDN-IHWYPQMZSA-N |
| XLogP | -1.57 |
| TPSA | 189.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|