C31H61NO — CID 160607060
bis(tert-butylcyclohexane);1-(4-tert-butylpiperidin-1-yl)ethanone (PubChem CID 160607060) has the molecular formula C31H61NO and a molecular weight of 463.84 g/mol. Its IUPAC name is bis(tert-butylcyclohexane);1-(4-tert-butylpiperidin-1-yl)ethanone.
| Compound Name | bis(tert-butylcyclohexane);1-(4-tert-butylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 160607060 |
| Molecular Formula | C31H61NO |
| Molecular Weight | 463.84 g/mol |
| Exact Mass | 463.48 |
| IUPAC Name | bis(tert-butylcyclohexane);1-(4-tert-butylpiperidin-1-yl)ethanone |
| SMILES | CC(=O)N1CCC(C(C)(C)C)CC1.CC(C)(C)C1CCCCC1.CC(C)(C)C1CCCCC1 |
| InChI | InChI=1S/C11H21NO.2C10H20/c1-9(13)12-7-5-10(6-8-12)11(2,3)4;2*1-10(2,3)9-7-5-4-6-8-9/h10H,5-8H2,1-4H3;2*9H,4-8H2,1-3H3 |
| InChIKey | REZYKUBUEFOBGN-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.84 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |