C44H38N6O — CID 160608826
N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-pyridin-4-yl-1-trityl-7H-pyrrolo[2,3-f]indazole-6-carboxamide (PubChem CID 160608826) has the molecular formula C44H38N6O and a molecular weight of 666.83 g/mol. Its IUPAC name is N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-pyridin-4-yl-1-trityl-7H-pyrrolo[2,3-f]indazole-6-carboxamide.
| Compound Name | N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-pyridin-4-yl-1-trityl-7H-pyrrolo[2,3-f]indazole-6-carboxamide |
|---|---|
| PubChem CID | 160608826 |
| Molecular Formula | C44H38N6O |
| Molecular Weight | 666.83 g/mol |
| Exact Mass | 666.31 |
| IUPAC Name | N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-pyridin-4-yl-1-trityl-7H-pyrrolo[2,3-f]indazole-6-carboxamide |
| SMILES | CN(C)C[C@@H](NC(=O)C1=Nc2cc3c(-c4ccncc4)nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3cc2C1)c1ccccc1 |
| InChI | InChI=1S/C44H38N6O/c1-49(2)30-40(31-15-7-3-8-16-31)47-43(51)39-27-33-28-41-37(29-38(33)46-39)42(32-23-25-45-26-24-32)48-50(41)44(34-17-9-4-10-18-34,35-19-11-5-12-20-35)36-21-13-6-14-22-36/h3-26,28-29,40H,27,30H2,1-2H3,(H,47,51)/t40-/m1/s1 |
| InChIKey | DIAVFPUJTZGWCX-RRHRGVEJSA-N |
| XLogP | 7.99 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.83 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|