C44H39N7O — CID 155166405
N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-pyridin-4-yl-1-(2,2,2-triphenylethyl)-2H-imidazo[4,5-f]indazole-6-carboxamide (PubChem CID 155166405) has the molecular formula C44H39N7O and a molecular weight of 681.84 g/mol. Its IUPAC name is N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-pyridin-4-yl-1-(2,2,2-triphenylethyl)-2H-imidazo[4,5-f]indazole-6-carboxamide.
| Compound Name | N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-pyridin-4-yl-1-(2,2,2-triphenylethyl)-2H-imidazo[4,5-f]indazole-6-carboxamide |
|---|---|
| PubChem CID | 155166405 |
| Molecular Formula | C44H39N7O |
| Molecular Weight | 681.84 g/mol |
| Exact Mass | 681.32 |
| IUPAC Name | N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-pyridin-4-yl-1-(2,2,2-triphenylethyl)-2H-imidazo[4,5-f]indazole-6-carboxamide |
| SMILES | CN(C)C[C@@H](NC(=O)c1nc2cc3c(-c4ccncc4)[nH]n(CC(c4ccccc4)(c4ccccc4)c4ccccc4)c3cc2n1)c1ccccc1 |
| InChI | InChI=1S/C44H39N7O/c1-50(2)29-39(31-15-7-3-8-16-31)48-43(52)42-46-37-27-36-40(28-38(37)47-42)51(49-41(36)32-23-25-45-26-24-32)30-44(33-17-9-4-10-18-33,34-19-11-5-12-20-34)35-21-13-6-14-22-35/h3-28,39,49H,29-30H2,1-2H3,(H,48,52)/t39-/m1/s1 |
| InChIKey | WSBALJYVEOLERO-LDLOPFEMSA-N |
| XLogP | 8.04 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.84 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|