C43H36N6O — CID 155166324
N-[(2R)-1-phenylpropan-2-yl]-3-pyridin-4-yl-1-(2,2,2-triphenylethyl)-2H-imidazo[4,5-f]indazole-6-carboxamide (PubChem CID 155166324) has the molecular formula C43H36N6O and a molecular weight of 652.80 g/mol. Its IUPAC name is N-[(2R)-1-phenylpropan-2-yl]-3-pyridin-4-yl-1-(2,2,2-triphenylethyl)-2H-imidazo[4,5-f]indazole-6-carboxamide.
| Compound Name | N-[(2R)-1-phenylpropan-2-yl]-3-pyridin-4-yl-1-(2,2,2-triphenylethyl)-2H-imidazo[4,5-f]indazole-6-carboxamide |
|---|---|
| PubChem CID | 155166324 |
| Molecular Formula | C43H36N6O |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | N-[(2R)-1-phenylpropan-2-yl]-3-pyridin-4-yl-1-(2,2,2-triphenylethyl)-2H-imidazo[4,5-f]indazole-6-carboxamide |
| SMILES | C[C@H](Cc1ccccc1)NC(=O)c1nc2cc3c(-c4ccncc4)[nH]n(CC(c4ccccc4)(c4ccccc4)c4ccccc4)c3cc2n1 |
| InChI | InChI=1S/C43H36N6O/c1-30(26-31-14-6-2-7-15-31)45-42(50)41-46-37-27-36-39(28-38(37)47-41)49(48-40(36)32-22-24-44-25-23-32)29-43(33-16-8-3-9-17-33,34-18-10-4-11-19-34)35-20-12-5-13-21-35/h2-25,27-28,30,48H,26,29H2,1H3,(H,45,50)/t30-/m1/s1 |
| InChIKey | KJHDIGKYHSEASY-SSEXGKCCSA-N |
| XLogP | 8.37 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|