C22H19N7O — CID 154616337
N-[1-(4-aminophenyl)ethyl]-3-pyridin-4-yl-1,2-dihydroimidazo[4,5-f]indazole-6-carboxamide (PubChem CID 154616337) has the molecular formula C22H19N7O and a molecular weight of 397.44 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)ethyl]-3-pyridin-4-yl-1,2-dihydroimidazo[4,5-f]indazole-6-carboxamide.
| Compound Name | N-[1-(4-aminophenyl)ethyl]-3-pyridin-4-yl-1,2-dihydroimidazo[4,5-f]indazole-6-carboxamide |
|---|---|
| PubChem CID | 154616337 |
| Molecular Formula | C22H19N7O |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[1-(4-aminophenyl)ethyl]-3-pyridin-4-yl-1,2-dihydroimidazo[4,5-f]indazole-6-carboxamide |
| SMILES | CC(NC(=O)c1nc2cc3[nH][nH]c(-c4ccncc4)c3cc2n1)c1ccc(N)cc1 |
| InChI | InChI=1S/C22H19N7O/c1-12(13-2-4-15(23)5-3-13)25-22(30)21-26-18-10-16-17(11-19(18)27-21)28-29-20(16)14-6-8-24-9-7-14/h2-12,28-29H,23H2,1H3,(H,25,30) |
| InChIKey | UMPWHMMLTRUEDY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|