C24H21N5O2 — CID 176538799
3-[4-(oxomethylidene)cyclohexen-1-yl]-N-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-f]indazole-6-carboxamide (PubChem CID 176538799) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 3-[4-(oxomethylidene)cyclohexen-1-yl]-N-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-f]indazole-6-carboxamide.
| Compound Name | 3-[4-(oxomethylidene)cyclohexen-1-yl]-N-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-f]indazole-6-carboxamide |
|---|---|
| PubChem CID | 176538799 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 3-[4-(oxomethylidene)cyclohexen-1-yl]-N-[(1R)-1-phenylethyl]-1,2-dihydroimidazo[4,5-f]indazole-6-carboxamide |
| SMILES | C[C@@H](NC(=O)c1nc2cc3[nH][nH]c(C4=CCC(=C=O)CC4)c3cc2n1)c1ccccc1 |
| InChI | InChI=1S/C24H21N5O2/c1-14(16-5-3-2-4-6-16)25-24(31)23-26-20-11-18-19(12-21(20)27-23)28-29-22(18)17-9-7-15(13-30)8-10-17/h2-6,9,11-12,14,28-29H,7-8,10H2,1H3,(H,25,31)/t14-/m1/s1 |
| InChIKey | NBFAKGJCYJLRNZ-CQSZACIVSA-N |
| XLogP | 4.26 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|