C22H19ClN6O — CID 155073594
[[(1R)-1-(3-chlorophenyl)ethyl]amino]-(3-pyridin-4-yl-1,2-dihydroimidazo[4,5-f]indazol-6-yl)methanol (PubChem CID 155073594) has the molecular formula C22H19ClN6O and a molecular weight of 418.89 g/mol. Its IUPAC name is [[(1R)-1-(3-chlorophenyl)ethyl]amino]-(3-pyridin-4-yl-1,2-dihydroimidazo[4,5-f]indazol-6-yl)methanol.
| Compound Name | [[(1R)-1-(3-chlorophenyl)ethyl]amino]-(3-pyridin-4-yl-1,2-dihydroimidazo[4,5-f]indazol-6-yl)methanol |
|---|---|
| PubChem CID | 155073594 |
| Molecular Formula | C22H19ClN6O |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [[(1R)-1-(3-chlorophenyl)ethyl]amino]-(3-pyridin-4-yl-1,2-dihydroimidazo[4,5-f]indazol-6-yl)methanol |
| SMILES | C[C@@H](NC(O)c1nc2cc3[nH][nH]c(-c4ccncc4)c3cc2n1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H19ClN6O/c1-12(14-3-2-4-15(23)9-14)25-22(30)21-26-18-10-16-17(11-19(18)27-21)28-29-20(16)13-5-7-24-8-6-13/h2-12,22,25,28-30H,1H3/t12-,22?/m1/s1 |
| InChIKey | PVGBUBUQZXGFRY-PMOHQLOOSA-N |
| XLogP | 4.50 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|