C29H42BN3O6 — CID 160609277
N-[(2S)-1-[(4R)-4-hydroxy-2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]acetamide (PubChem CID 160609277) has the molecular formula C29H42BN3O6 and a molecular weight of 539.48 g/mol. Its IUPAC name is N-[(2S)-1-[(4R)-4-hydroxy-2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-[(4R)-4-hydroxy-2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 160609277 |
| Molecular Formula | C29H42BN3O6 |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | N-[(2S)-1-[(4R)-4-hydroxy-2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](C(=O)N1C[C@H](O)CC1C1=NC(=O)C(C)(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)C(C)(C)C |
| InChI | InChI=1S/C29H42BN3O6/c1-17(34)31-23(26(2,3)4)24(36)33-16-20(35)14-22(33)21-15-29(9,25(37)32-21)18-10-12-19(13-11-18)30-38-27(5,6)28(7,8)39-30/h10-13,20,22-23,35H,14-16H2,1-9H3,(H,31,34)/t20-,22?,23-,29?/m1/s1 |
| InChIKey | VGEBOBDHPNRDLE-JVRWCIMYSA-N |
| XLogP | 2.13 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|