C26H37BN2O6 — CID 157353939
tert-butyl (4R)-4-hydroxy-2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 157353939) has the molecular formula C26H37BN2O6 and a molecular weight of 484.40 g/mol. Its IUPAC name is tert-butyl (4R)-4-hydroxy-2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4R)-4-hydroxy-2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157353939 |
| Molecular Formula | C26H37BN2O6 |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | tert-butyl (4R)-4-hydroxy-2-[4-methyl-5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)CC1C1=NC(=O)C(C)(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C26H37BN2O6/c1-23(2,3)33-22(32)29-15-18(30)13-20(29)19-14-26(8,21(31)28-19)16-9-11-17(12-10-16)27-34-24(4,5)25(6,7)35-27/h9-12,18,20,30H,13-15H2,1-8H3/t18-,20?,26?/m1/s1 |
| InChIKey | JKXLUGVGHGQGGQ-ZSNWSCRSSA-N |
| XLogP | 2.99 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|