C25H35BN2O5 — CID 58490826
tert-butyl (2S,4R)-4-hydroxy-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 58490826) has the molecular formula C25H35BN2O5 and a molecular weight of 454.38 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-hydroxy-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-hydroxy-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58490826 |
| Molecular Formula | C25H35BN2O5 |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | tert-butyl (2S,4R)-4-hydroxy-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)C[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C25H35BN2O5/c1-23(2,3)31-22(30)28-15-19(29)13-21(28)20-12-17(14-27-20)16-8-10-18(11-9-16)26-32-24(4,5)25(6,7)33-26/h8-11,14,19,21,29H,12-13,15H2,1-7H3/t19-,21+/m1/s1 |
| InChIKey | HPLONCIYOAITMU-CTNGQTDRSA-N |
| XLogP | 3.54 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|