C17H28N4O2 — CID 160610393
cyclohex-3-ene-1-carboxamide;5-piperidin-1-yl-3-propan-2-yl-1,2,4-oxadiazole (PubChem CID 160610393) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is cyclohex-3-ene-1-carboxamide;5-piperidin-1-yl-3-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | cyclohex-3-ene-1-carboxamide;5-piperidin-1-yl-3-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 160610393 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | cyclohex-3-ene-1-carboxamide;5-piperidin-1-yl-3-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)c1noc(N2CCCCC2)n1.NC(=O)C1CC=CCC1 |
| InChI | InChI=1S/C10H17N3O.C7H11NO/c1-8(2)9-11-10(14-12-9)13-6-4-3-5-7-13;8-7(9)6-4-2-1-3-5-6/h8H,3-7H2,1-2H3;1-2,6H,3-5H2,(H2,8,9) |
| InChIKey | RFLCVQYMAGKFCD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|