About 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine
2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine (PubChem CID 160610783) has the molecular formula C16H12Cl3FN4O
and a molecular weight of 401.66 g/mol. Its IUPAC name is 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine.
Molecular Properties
| Compound Name | 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine |
| PubChem CID | 160610783 |
| Molecular Formula | C16H12Cl3FN4O |
| Molecular Weight | 401.66 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine |
| SMILES | Cc1cc(Cl)nc(Cl)n1.Cc1cc(Oc2ccc(F)cc2)nc(Cl)n1 |
| InChI | InChI=1S/C11H8ClFN2O.C5H4Cl2N2/c1-7-6-10(15-11(12)14-7)16-9-4-2-8(13)3-5-9;1-3-2-4(6)9-5(7)8-3/h2-6H,1H3;2H,1H3 |
| InChIKey | RFMHAVFKTGNZES-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.66 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine?
The IUPAC name of 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine (CID 160610783) is 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine.
What is the SMILES notation for 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine?
The canonical SMILES for 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine is Cc1cc(Cl)nc(Cl)n1.Cc1cc(Oc2ccc(F)cc2)nc(Cl)n1.
What is the InChIKey of 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine?
The InChIKey is RFMHAVFKTGNZES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClFN2O.C5H4Cl2N2/c1-7-6-10(15-11(12)14-7)16-9-4-2-8(13)3-5-9;1-3-2-4(6)9-5(7)8-3/h2-6H,1H3;2H,1H3.
What are the key properties of 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine?
2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine has a molecular weight of 401.66 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;2,4-dichloro-6-methylpyrimidine is sourced from PubChem (CID 160610783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).