C32H38N4O4S3 — CID 160612145
3-[[5-(azetidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]sulfonyl]-1H-pyrrole;[6-(1,3-thiazol-5-ylsulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine (PubChem CID 160612145) has the molecular formula C32H38N4O4S3 and a molecular weight of 638.88 g/mol. Its IUPAC name is 3-[[5-(azetidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]sulfonyl]-1H-pyrrole;[6-(1,3-thiazol-5-ylsulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine.
| Compound Name | 3-[[5-(azetidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]sulfonyl]-1H-pyrrole;[6-(1,3-thiazol-5-ylsulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine |
|---|---|
| PubChem CID | 160612145 |
| Molecular Formula | C32H38N4O4S3 |
| Molecular Weight | 638.88 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | 3-[[5-(azetidin-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]sulfonyl]-1H-pyrrole;[6-(1,3-thiazol-5-ylsulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine |
| SMILES | NCC1CCCc2cc(S(=O)(=O)c3cncs3)ccc21.O=S(=O)(c1cc[nH]c1)c1ccc2c(c1)CCCC2CN1CCC1 |
| InChI | InChI=1S/C18H22N2O2S.C14H16N2O2S2/c21-23(22,17-7-8-19-12-17)16-5-6-18-14(11-16)3-1-4-15(18)13-20-9-2-10-20;15-7-11-3-1-2-10-6-12(4-5-13(10)11)20(17,18)14-8-16-9-19-14/h5-8,11-12,15,19H,1-4,9-10,13H2;4-6,8-9,11H,1-3,7,15H2 |
| InChIKey | RFPXOQVWPLEIRE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.88 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |