C50H74O7 — CID 160612211
19-[3-[10-(3-nonanoylphenyl)-10-oxodecanoyl]phenyl]-10,19-dioxononadecanoic acid (PubChem CID 160612211) has the molecular formula C50H74O7 and a molecular weight of 787.14 g/mol. Its IUPAC name is 19-[3-[10-(3-nonanoylphenyl)-10-oxodecanoyl]phenyl]-10,19-dioxononadecanoic acid.
| Compound Name | 19-[3-[10-(3-nonanoylphenyl)-10-oxodecanoyl]phenyl]-10,19-dioxononadecanoic acid |
|---|---|
| PubChem CID | 160612211 |
| Molecular Formula | C50H74O7 |
| Molecular Weight | 787.14 g/mol |
| Exact Mass | 786.54 |
| IUPAC Name | 19-[3-[10-(3-nonanoylphenyl)-10-oxodecanoyl]phenyl]-10,19-dioxononadecanoic acid |
| SMILES | CCCCCCCCC(=O)c1cccc(C(=O)CCCCCCCCC(=O)c2cccc(C(=O)CCCCCCCCC(=O)CCCCCCCCC(=O)O)c2)c1 |
| InChI | InChI=1S/C50H74O7/c1-2-3-4-5-14-21-34-46(52)41-28-26-29-42(39-41)48(54)36-23-16-9-10-17-24-37-49(55)44-31-27-30-43(40-44)47(53)35-22-15-8-6-12-19-32-45(51)33-20-13-7-11-18-25-38-50(56)57/h26-31,39-40H,2-25,32-38H2,1H3,(H,56,57) |
| InChIKey | DNNNCUUNXBCHIJ-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.14 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|