About 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide
1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide (PubChem CID 159969229) has the molecular formula C25H30O6
and a molecular weight of 426.51 g/mol. Its IUPAC name is 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide.
Molecular Properties
| Compound Name | 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide |
| PubChem CID | 159969229 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide |
| SMILES | CCCCCCCCC(=O)c1cccc(C(C)=O)c1.O=C(O)c1ccccc1.O=C=O |
| InChI | InChI=1S/C17H24O2.C7H6O2.CO2/c1-3-4-5-6-7-8-12-17(19)16-11-9-10-15(13-16)14(2)18;8-7(9)6-4-2-1-3-5-6;2-1-3/h9-11,13H,3-8,12H2,1-2H3;1-5H,(H,8,9); |
| InChIKey | OEICRLDTHVMFHA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide?
The IUPAC name of 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide (CID 159969229) is 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide.
What is the SMILES notation for 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide?
The canonical SMILES for 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide is CCCCCCCCC(=O)c1cccc(C(C)=O)c1.O=C(O)c1ccccc1.O=C=O.
What is the InChIKey of 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide?
The InChIKey is OEICRLDTHVMFHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O2.C7H6O2.CO2/c1-3-4-5-6-7-8-12-17(19)16-11-9-10-15(13-16)14(2)18;8-7(9)6-4-2-1-3-5-6;2-1-3/h9-11,13H,3-8,12H2,1-2H3;1-5H,(H,8,9);.
What are the key properties of 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide?
1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide has a molecular weight of 426.51 g/mol, XLogP of 5.62, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-acetylphenyl)nonan-1-one;benzoic acid;carbon dioxide is sourced from PubChem (CID 159969229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).