C22H28FN5O3S — CID 160615216
1-[[(6S)-6-(2-fluoroethylamino)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]-methylidene-oxo-λ6-sulfanyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 160615216) has the molecular formula C22H28FN5O3S and a molecular weight of 461.56 g/mol. Its IUPAC name is 1-[[(6S)-6-(2-fluoroethylamino)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]-methylidene-oxo-λ6-sulfanyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[[(6S)-6-(2-fluoroethylamino)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]-methylidene-oxo-λ6-sulfanyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 160615216 |
| Molecular Formula | C22H28FN5O3S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1-[[(6S)-6-(2-fluoroethylamino)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]-methylidene-oxo-λ6-sulfanyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | C=S(=O)(NC(=O)Nc1c2c(cc3c1CCC3)CCC2)c1cnn2c1OC[C@@H](NCCF)C2 |
| InChI | InChI=1S/C22H28FN5O3S/c1-32(30,19-11-25-28-12-16(24-9-8-23)13-31-21(19)28)27-22(29)26-20-17-6-2-4-14(17)10-15-5-3-7-18(15)20/h10-11,16,24H,1-9,12-13H2,(H2,26,27,29,30)/t16-,32?/m0/s1 |
| InChIKey | BJQCKYYLVQGFFM-KXJSNILUSA-N |
| XLogP | 1.99 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|