C27H36FN5O5S — CID 160615217
tert-butyl N-(2-fluoroethyl)-N-[(6S)-3-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-methylidene-oxo-λ6-sulfanyl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-6-yl]carbamate (PubChem CID 160615217) has the molecular formula C27H36FN5O5S and a molecular weight of 561.68 g/mol. Its IUPAC name is tert-butyl N-(2-fluoroethyl)-N-[(6S)-3-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-methylidene-oxo-λ6-sulfanyl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-6-yl]carbamate.
| Compound Name | tert-butyl N-(2-fluoroethyl)-N-[(6S)-3-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-methylidene-oxo-λ6-sulfanyl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 160615217 |
| Molecular Formula | C27H36FN5O5S |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | tert-butyl N-(2-fluoroethyl)-N-[(6S)-3-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-methylidene-oxo-λ6-sulfanyl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-6-yl]carbamate |
| SMILES | C=S(=O)(NC(=O)Nc1c2c(cc3c1CCC3)CCC2)c1cnn2c1OC[C@@H](N(CCF)C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C27H36FN5O5S/c1-27(2,3)38-26(35)32(12-11-28)19-15-33-24(37-16-19)22(14-29-33)39(4,36)31-25(34)30-23-20-9-5-7-17(20)13-18-8-6-10-21(18)23/h13-14,19H,4-12,15-16H2,1-3H3,(H2,30,31,34,36)/t19-,39?/m0/s1 |
| InChIKey | SRYRJTSOELBLAN-UGMFIPNESA-N |
| XLogP | 3.64 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|