C18H16Cl2FN3O6S — CID 160615565
2-[(1R,3S)-3-amino-1-(4-chloro-1,3-thiazol-5-yl)-4-hydroxybutoxy]-4-chloro-5-fluorobenzonitrile;(E)-but-2-enedioic acid (PubChem CID 160615565) has the molecular formula C18H16Cl2FN3O6S and a molecular weight of 492.31 g/mol. Its IUPAC name is 2-[(1R,3S)-3-amino-1-(4-chloro-1,3-thiazol-5-yl)-4-hydroxybutoxy]-4-chloro-5-fluorobenzonitrile;(E)-but-2-enedioic acid.
| Compound Name | 2-[(1R,3S)-3-amino-1-(4-chloro-1,3-thiazol-5-yl)-4-hydroxybutoxy]-4-chloro-5-fluorobenzonitrile;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 160615565 |
| Molecular Formula | C18H16Cl2FN3O6S |
| Molecular Weight | 492.31 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | 2-[(1R,3S)-3-amino-1-(4-chloro-1,3-thiazol-5-yl)-4-hydroxybutoxy]-4-chloro-5-fluorobenzonitrile;(E)-but-2-enedioic acid |
| SMILES | N#Cc1cc(F)c(Cl)cc1O[C@H](C[C@H](N)CO)c1scnc1Cl.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H12Cl2FN3O2S.C4H4O4/c15-9-3-11(7(4-18)1-10(9)17)22-12(2-8(19)5-21)13-14(16)20-6-23-13;5-3(6)1-2-4(7)8/h1,3,6,8,12,21H,2,5,19H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t8-,12+;/m0./s1 |
| InChIKey | RGASSOQMRIFSMS-OPORHTSLSA-N |
| XLogP | 3.00 |
| TPSA | 166.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|