C21H21F2N3O5S — CID 158393377
2-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-6-(difluoromethyl)pyridine-3-carbonitrile;but-2-enedioic acid (PubChem CID 158393377) has the molecular formula C21H21F2N3O5S and a molecular weight of 465.48 g/mol. Its IUPAC name is 2-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-6-(difluoromethyl)pyridine-3-carbonitrile;but-2-enedioic acid.
| Compound Name | 2-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-6-(difluoromethyl)pyridine-3-carbonitrile;but-2-enedioic acid |
|---|---|
| PubChem CID | 158393377 |
| Molecular Formula | C21H21F2N3O5S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-6-(difluoromethyl)pyridine-3-carbonitrile;but-2-enedioic acid |
| SMILES | N#Cc1ccc(C(F)F)nc1S[C@H](C[C@H](N)CO)c1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H17F2N3OS.C4H4O4/c18-16(19)14-7-6-12(9-20)17(22-14)24-15(8-13(21)10-23)11-4-2-1-3-5-11;5-3(6)1-2-4(7)8/h1-7,13,15-16,23H,8,10,21H2;1-2H,(H,5,6)(H,7,8)/t13-,15+;/m0./s1 |
| InChIKey | GXFYYBHYHDGQNU-NQQJLSKUSA-N |
| XLogP | 3.15 |
| TPSA | 157.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|