C26H40N2O4 — CID 160620662
(3R)-1-[(1R,2S)-3-[(2S)-2-amino-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-but-3-ynyl-4-hydroxynon-8-ene-1,5-dione (PubChem CID 160620662) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is (3R)-1-[(1R,2S)-3-[(2S)-2-amino-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-but-3-ynyl-4-hydroxynon-8-ene-1,5-dione.
| Compound Name | (3R)-1-[(1R,2S)-3-[(2S)-2-amino-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-but-3-ynyl-4-hydroxynon-8-ene-1,5-dione |
|---|---|
| PubChem CID | 160620662 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | (3R)-1-[(1R,2S)-3-[(2S)-2-amino-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-but-3-ynyl-4-hydroxynon-8-ene-1,5-dione |
| SMILES | C#CCC[C@H](CC(=O)[C@@H]1[C@@H]2C(CN1C(=O)[C@@H](N)C(C)(C)C)C2(C)C)C(O)C(=O)CCC=C |
| InChI | InChI=1S/C26H40N2O4/c1-8-10-12-16(22(31)18(29)13-11-9-2)14-19(30)21-20-17(26(20,6)7)15-28(21)24(32)23(27)25(3,4)5/h1,9,16-17,20-23,31H,2,10-15,27H2,3-7H3/t16-,17?,20+,21-,22?,23-/m1/s1 |
| InChIKey | ZKLZPBOEFHHHTE-GQOLDARFSA-N |
| XLogP | 2.73 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|