C32H28BrF9O7S2 — CID 160621454
methyl 2-acetylsulfanyl-2-[4-(trifluoromethyl)phenyl]acetate;methyl 2-bromo-2-[4-(trifluoromethyl)phenyl]acetate;methyl 2-sulfanyl-2-[4-(trifluoromethyl)phenyl]acetate (PubChem CID 160621454) has the molecular formula C32H28BrF9O7S2 and a molecular weight of 839.59 g/mol. Its IUPAC name is methyl 2-acetylsulfanyl-2-[4-(trifluoromethyl)phenyl]acetate;methyl 2-bromo-2-[4-(trifluoromethyl)phenyl]acetate;methyl 2-sulfanyl-2-[4-(trifluoromethyl)phenyl]acetate.
| Compound Name | methyl 2-acetylsulfanyl-2-[4-(trifluoromethyl)phenyl]acetate;methyl 2-bromo-2-[4-(trifluoromethyl)phenyl]acetate;methyl 2-sulfanyl-2-[4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 160621454 |
| Molecular Formula | C32H28BrF9O7S2 |
| Molecular Weight | 839.59 g/mol |
| Exact Mass | 838.03 |
| IUPAC Name | methyl 2-acetylsulfanyl-2-[4-(trifluoromethyl)phenyl]acetate;methyl 2-bromo-2-[4-(trifluoromethyl)phenyl]acetate;methyl 2-sulfanyl-2-[4-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(=O)C(Br)c1ccc(C(F)(F)F)cc1.COC(=O)C(S)c1ccc(C(F)(F)F)cc1.COC(=O)C(SC(C)=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3O3S.C10H8BrF3O2.C10H9F3O2S/c1-7(16)19-10(11(17)18-2)8-3-5-9(6-4-8)12(13,14)15;1-16-9(15)8(11)6-2-4-7(5-3-6)10(12,13)14;1-15-9(14)8(16)6-2-4-7(5-3-6)10(11,12)13/h3-6,10H,1-2H3;2-5,8H,1H3;2-5,8,16H,1H3 |
| InChIKey | RGTGUYPQVZIUPD-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 95.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.59 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|