C18H16BrF3O2S — CID 51349998
ethyl 2-bromo-2-[4-[[3-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]acetate (PubChem CID 51349998) has the molecular formula C18H16BrF3O2S and a molecular weight of 433.29 g/mol. Its IUPAC name is ethyl 2-bromo-2-[4-[[3-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]acetate.
| Compound Name | ethyl 2-bromo-2-[4-[[3-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]acetate |
|---|---|
| PubChem CID | 51349998 |
| Molecular Formula | C18H16BrF3O2S |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | ethyl 2-bromo-2-[4-[[3-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]acetate |
| SMILES | CCOC(=O)C(Br)c1ccc(CSc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H16BrF3O2S/c1-2-24-17(23)16(19)13-8-6-12(7-9-13)11-25-15-5-3-4-14(10-15)18(20,21)22/h3-10,16H,2,11H2,1H3 |
| InChIKey | YUAHHIROCQSAGT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|