C24H22F4O2S — CID 145473161
ethane;methyl 2-[3-[3-[2-fluoro-4-(trifluoromethyl)phenyl]phenyl]sulfanylphenyl]acetate (PubChem CID 145473161) has the molecular formula C24H22F4O2S and a molecular weight of 450.50 g/mol. Its IUPAC name is ethane;methyl 2-[3-[3-[2-fluoro-4-(trifluoromethyl)phenyl]phenyl]sulfanylphenyl]acetate.
| Compound Name | ethane;methyl 2-[3-[3-[2-fluoro-4-(trifluoromethyl)phenyl]phenyl]sulfanylphenyl]acetate |
|---|---|
| PubChem CID | 145473161 |
| Molecular Formula | C24H22F4O2S |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | ethane;methyl 2-[3-[3-[2-fluoro-4-(trifluoromethyl)phenyl]phenyl]sulfanylphenyl]acetate |
| SMILES | CC.COC(=O)Cc1cccc(Sc2cccc(-c3ccc(C(F)(F)F)cc3F)c2)c1 |
| InChI | InChI=1S/C22H16F4O2S.C2H6/c1-28-21(27)11-14-4-2-6-17(10-14)29-18-7-3-5-15(12-18)19-9-8-16(13-20(19)23)22(24,25)26;1-2/h2-10,12-13H,11H2,1H3;1-2H3 |
| InChIKey | XFVXJLUAVMVBLF-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |