C14H22N6O6 — CID 160625795
1-(3-methoxypropyl)-3-nitropyrazole;1-(3-methoxypropyl)-5-nitropyrazole (PubChem CID 160625795) has the molecular formula C14H22N6O6 and a molecular weight of 370.37 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-nitropyrazole;1-(3-methoxypropyl)-5-nitropyrazole.
| Compound Name | 1-(3-methoxypropyl)-3-nitropyrazole;1-(3-methoxypropyl)-5-nitropyrazole |
|---|---|
| PubChem CID | 160625795 |
| Molecular Formula | C14H22N6O6 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-(3-methoxypropyl)-3-nitropyrazole;1-(3-methoxypropyl)-5-nitropyrazole |
| SMILES | COCCCn1ccc([N+](=O)[O-])n1.COCCCn1nccc1[N+](=O)[O-] |
| InChI | InChI=1S/2C7H11N3O3/c1-13-6-2-5-9-7(10(11)12)3-4-8-9;1-13-6-2-4-9-5-3-7(8-9)10(11)12/h3-4H,2,5-6H2,1H3;3,5H,2,4,6H2,1H3 |
| InChIKey | RHGYGKPYVGKUOQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 140.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|