C14H20N6O4 — CID 48506880
N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-(3-nitropyrazol-1-yl)acetamide (PubChem CID 48506880) has the molecular formula C14H20N6O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-(3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-(3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 48506880 |
| Molecular Formula | C14H20N6O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-(3-nitropyrazol-1-yl)acetamide |
| SMILES | COCCn1nc(C)c(CNC(=O)Cn2ccc([N+](=O)[O-])n2)c1C |
| InChI | InChI=1S/C14H20N6O4/c1-10-12(11(2)19(16-10)6-7-24-3)8-15-14(21)9-18-5-4-13(17-18)20(22)23/h4-5H,6-9H2,1-3H3,(H,15,21) |
| InChIKey | DMMAOXXWNOKOHP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|