C12H14BrN7O4 — CID 35208736
N'-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)acetyl]-2-(3-nitropyrazol-1-yl)acetohydrazide (PubChem CID 35208736) has the molecular formula C12H14BrN7O4 and a molecular weight of 400.19 g/mol. Its IUPAC name is N'-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)acetyl]-2-(3-nitropyrazol-1-yl)acetohydrazide.
| Compound Name | N'-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)acetyl]-2-(3-nitropyrazol-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 35208736 |
| Molecular Formula | C12H14BrN7O4 |
| Molecular Weight | 400.19 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | N'-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)acetyl]-2-(3-nitropyrazol-1-yl)acetohydrazide |
| SMILES | Cc1nn(CC(=O)NNC(=O)Cn2ccc([N+](=O)[O-])n2)c(C)c1Br |
| InChI | InChI=1S/C12H14BrN7O4/c1-7-12(13)8(2)19(16-7)6-11(22)15-14-10(21)5-18-4-3-9(17-18)20(23)24/h3-4H,5-6H2,1-2H3,(H,14,21)(H,15,22) |
| InChIKey | RTQDNWLDXXCXNL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|