C10H10IN5O3 — CID 1257363
1-(4-iodo-3,5-dimethylpyrazol-1-yl)-2-(3-nitropyrazol-1-yl)ethanone (PubChem CID 1257363) has the molecular formula C10H10IN5O3 and a molecular weight of 375.13 g/mol. Its IUPAC name is 1-(4-iodo-3,5-dimethylpyrazol-1-yl)-2-(3-nitropyrazol-1-yl)ethanone.
| Compound Name | 1-(4-iodo-3,5-dimethylpyrazol-1-yl)-2-(3-nitropyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 1257363 |
| Molecular Formula | C10H10IN5O3 |
| Molecular Weight | 375.13 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 1-(4-iodo-3,5-dimethylpyrazol-1-yl)-2-(3-nitropyrazol-1-yl)ethanone |
| SMILES | Cc1nn(C(=O)Cn2ccc([N+](=O)[O-])n2)c(C)c1I |
| InChI | InChI=1S/C10H10IN5O3/c1-6-10(11)7(2)15(12-6)9(17)5-14-4-3-8(13-14)16(18)19/h3-4H,5H2,1-2H3 |
| InChIKey | WLEFGNUUIFGXNV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 95.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.13 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|