C20H35NO8 — CID 160627870
3-hydroxypropyl prop-2-enoate;octanamide;bis(prop-2-enoic acid) (PubChem CID 160627870) has the molecular formula C20H35NO8 and a molecular weight of 417.50 g/mol. Its IUPAC name is 3-hydroxypropyl prop-2-enoate;octanamide;bis(prop-2-enoic acid).
| Compound Name | 3-hydroxypropyl prop-2-enoate;octanamide;bis(prop-2-enoic acid) |
|---|---|
| PubChem CID | 160627870 |
| Molecular Formula | C20H35NO8 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 3-hydroxypropyl prop-2-enoate;octanamide;bis(prop-2-enoic acid) |
| SMILES | C=CC(=O)O.C=CC(=O)O.C=CC(=O)OCCCO.CCCCCCCC(N)=O |
| InChI | InChI=1S/C8H17NO.C6H10O3.2C3H4O2/c1-2-3-4-5-6-7-8(9)10;1-2-6(8)9-5-3-4-7;2*1-2-3(4)5/h2-7H2,1H3,(H2,9,10);2,7H,1,3-5H2;2*2H,1H2,(H,4,5) |
| InChIKey | RHNRLJZVMKZSGW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 164.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|