C25H27F4N3O5S — CID 160629065
N-(5-fluoro-2-methoxyphenyl)-4-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3-thiazol-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 160629065) has the molecular formula C25H27F4N3O5S and a molecular weight of 557.57 g/mol. Its IUPAC name is N-(5-fluoro-2-methoxyphenyl)-4-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3-thiazol-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-(5-fluoro-2-methoxyphenyl)-4-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3-thiazol-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 160629065 |
| Molecular Formula | C25H27F4N3O5S |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | N-(5-fluoro-2-methoxyphenyl)-4-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3-thiazol-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(F)cc1Nc1nc(-c2ccc(OCCCN3CCOCC3)cc2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H26FN3O3S.C2HF3O2/c1-28-22-8-5-18(24)15-20(22)25-23-26-21(16-31-23)17-3-6-19(7-4-17)30-12-2-9-27-10-13-29-14-11-27;3-2(4,5)1(6)7/h3-8,15-16H,2,9-14H2,1H3,(H,25,26);(H,6,7) |
| InChIKey | RHROKMZHBDNQEL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|