About 4-fluoro-3-hydroxybenzaldehyde;tribromoborane
4-fluoro-3-hydroxybenzaldehyde;tribromoborane (PubChem CID 160631935) has the molecular formula C7H5BBr3FO2
and a molecular weight of 390.64 g/mol. Its IUPAC name is 4-fluoro-3-hydroxybenzaldehyde;tribromoborane.
Molecular Properties
| Compound Name | 4-fluoro-3-hydroxybenzaldehyde;tribromoborane |
| PubChem CID | 160631935 |
| Molecular Formula | C7H5BBr3FO2 |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 387.79 |
| IUPAC Name | 4-fluoro-3-hydroxybenzaldehyde;tribromoborane |
| SMILES | BrB(Br)Br.O=Cc1ccc(F)c(O)c1 |
| InChI | InChI=1S/C7H5FO2.BBr3/c8-6-2-1-5(4-9)3-7(6)10;2-1(3)4/h1-4,10H; |
| InChIKey | RIAJIYRIKWGEQD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-3-hydroxybenzaldehyde;tribromoborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-hydroxybenzaldehyde;tribromoborane?
The IUPAC name of 4-fluoro-3-hydroxybenzaldehyde;tribromoborane (CID 160631935) is 4-fluoro-3-hydroxybenzaldehyde;tribromoborane.
What is the SMILES notation for 4-fluoro-3-hydroxybenzaldehyde;tribromoborane?
The canonical SMILES for 4-fluoro-3-hydroxybenzaldehyde;tribromoborane is BrB(Br)Br.O=Cc1ccc(F)c(O)c1.
What is the InChIKey of 4-fluoro-3-hydroxybenzaldehyde;tribromoborane?
The InChIKey is RIAJIYRIKWGEQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FO2.BBr3/c8-6-2-1-5(4-9)3-7(6)10;2-1(3)4/h1-4,10H;.
What are the key properties of 4-fluoro-3-hydroxybenzaldehyde;tribromoborane?
4-fluoro-3-hydroxybenzaldehyde;tribromoborane has a molecular weight of 390.64 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-hydroxybenzaldehyde;tribromoborane is sourced from PubChem (CID 160631935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).