C52H42F2N8O4 — CID 160635046
3-[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]propan-1-amine (PubChem CID 160635046) has the molecular formula C52H42F2N8O4 and a molecular weight of 880.96 g/mol. Its IUPAC name is 3-[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]propan-1-amine.
| Compound Name | 3-[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 160635046 |
| Molecular Formula | C52H42F2N8O4 |
| Molecular Weight | 880.96 g/mol |
| Exact Mass | 880.33 |
| IUPAC Name | 3-[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]propan-1-amine |
| SMILES | NCCCc1ccc(-n2cnc3cnc4cc(F)c(-c5ccc6c(c5)OCO6)cc4c32)cc1.NCCCc1ccc(-n2cnc3cnc4cc(F)c(-c5ccc6c(c5)OCO6)cc4c32)cc1 |
| InChI | InChI=1S/2C26H21FN4O2/c2*27-21-12-22-20(11-19(21)17-5-8-24-25(10-17)33-15-32-24)26-23(13-29-22)30-14-31(26)18-6-3-16(4-7-18)2-1-9-28/h2*3-8,10-14H,1-2,9,15,28H2 |
| InChIKey | RIKUGMWZBWZTMV-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 150.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.96 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |