C32H30Cl2F2N4O3 — CID 160635844
4-[6-chloro-4-[difluoro(phenyl)methyl]-2-pyridinyl]morpholine;(2-chloro-6-morpholin-4-yl-4-pyridinyl)-phenylmethanone (PubChem CID 160635844) has the molecular formula C32H30Cl2F2N4O3 and a molecular weight of 627.52 g/mol. Its IUPAC name is 4-[6-chloro-4-[difluoro(phenyl)methyl]-2-pyridinyl]morpholine;(2-chloro-6-morpholin-4-yl-4-pyridinyl)-phenylmethanone.
| Compound Name | 4-[6-chloro-4-[difluoro(phenyl)methyl]-2-pyridinyl]morpholine;(2-chloro-6-morpholin-4-yl-4-pyridinyl)-phenylmethanone |
|---|---|
| PubChem CID | 160635844 |
| Molecular Formula | C32H30Cl2F2N4O3 |
| Molecular Weight | 627.52 g/mol |
| Exact Mass | 626.17 |
| IUPAC Name | 4-[6-chloro-4-[difluoro(phenyl)methyl]-2-pyridinyl]morpholine;(2-chloro-6-morpholin-4-yl-4-pyridinyl)-phenylmethanone |
| SMILES | FC(F)(c1ccccc1)c1cc(Cl)nc(N2CCOCC2)c1.O=C(c1ccccc1)c1cc(Cl)nc(N2CCOCC2)c1 |
| InChI | InChI=1S/C16H15ClF2N2O.C16H15ClN2O2/c17-14-10-13(16(18,19)12-4-2-1-3-5-12)11-15(20-14)21-6-8-22-9-7-21;17-14-10-13(16(20)12-4-2-1-3-5-12)11-15(18-14)19-6-8-21-9-7-19/h1-5,10-11H,6-9H2;1-5,10-11H,6-9H2 |
| InChIKey | RINHSESAWLXAAO-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.52 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|