C28H37FN2O — CID 160639467
1-[4-[4-[cyclobutyl(phenyl)methyl]piperazin-1-yl]-3-fluorophenyl]-3-ethylpentan-2-one (PubChem CID 160639467) has the molecular formula C28H37FN2O and a molecular weight of 436.62 g/mol. Its IUPAC name is 1-[4-[4-[cyclobutyl(phenyl)methyl]piperazin-1-yl]-3-fluorophenyl]-3-ethylpentan-2-one.
| Compound Name | 1-[4-[4-[cyclobutyl(phenyl)methyl]piperazin-1-yl]-3-fluorophenyl]-3-ethylpentan-2-one |
|---|---|
| PubChem CID | 160639467 |
| Molecular Formula | C28H37FN2O |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | 1-[4-[4-[cyclobutyl(phenyl)methyl]piperazin-1-yl]-3-fluorophenyl]-3-ethylpentan-2-one |
| SMILES | CCC(CC)C(=O)Cc1ccc(N2CCN(C(c3ccccc3)C3CCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C28H37FN2O/c1-3-22(4-2)27(32)20-21-13-14-26(25(29)19-21)30-15-17-31(18-16-30)28(24-11-8-12-24)23-9-6-5-7-10-23/h5-7,9-10,13-14,19,22,24,28H,3-4,8,11-12,15-18,20H2,1-2H3 |
| InChIKey | RIZDEMLMPTXIKG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |