C30H27ClN8O4 — CID 160639694
N-[(4-chloro-2-nitrophenyl)methyl]-2-methylindazol-5-amine;2-methyl-N-[(2-nitrophenyl)methyl]indazol-5-amine (PubChem CID 160639694) has the molecular formula C30H27ClN8O4 and a molecular weight of 599.05 g/mol. Its IUPAC name is N-[(4-chloro-2-nitrophenyl)methyl]-2-methylindazol-5-amine;2-methyl-N-[(2-nitrophenyl)methyl]indazol-5-amine.
| Compound Name | N-[(4-chloro-2-nitrophenyl)methyl]-2-methylindazol-5-amine;2-methyl-N-[(2-nitrophenyl)methyl]indazol-5-amine |
|---|---|
| PubChem CID | 160639694 |
| Molecular Formula | C30H27ClN8O4 |
| Molecular Weight | 599.05 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | N-[(4-chloro-2-nitrophenyl)methyl]-2-methylindazol-5-amine;2-methyl-N-[(2-nitrophenyl)methyl]indazol-5-amine |
| SMILES | Cn1cc2cc(NCc3ccc(Cl)cc3[N+](=O)[O-])ccc2n1.Cn1cc2cc(NCc3ccccc3[N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C15H13ClN4O2.C15H14N4O2/c1-19-9-11-6-13(4-5-14(11)18-19)17-8-10-2-3-12(16)7-15(10)20(21)22;1-18-10-12-8-13(6-7-14(12)17-18)16-9-11-4-2-3-5-15(11)19(20)21/h2-7,9,17H,8H2,1H3;2-8,10,16H,9H2,1H3 |
| InChIKey | RIZYHNJPDIBZSW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 145.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.05 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|