About 1-benzyl-5-nitroindazole
1-benzyl-5-nitroindazole (PubChem CID 139048397) has the molecular formula C28H22N6O4
and a molecular weight of 506.52 g/mol. Its IUPAC name is 1-benzyl-5-nitroindazole.
Molecular Properties
| Compound Name | 1-benzyl-5-nitroindazole |
| PubChem CID | 139048397 |
| Molecular Formula | C28H22N6O4 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 1-benzyl-5-nitroindazole |
| SMILES | O=[N+]([O-])c1ccc2c(cnn2Cc2ccccc2)c1.O=[N+]([O-])c1ccc2c(cnn2Cc2ccccc2)c1 |
| InChI | InChI=1S/2C14H11N3O2/c2*18-17(19)13-6-7-14-12(8-13)9-15-16(14)10-11-4-2-1-3-5-11/h2*1-9H,10H2 |
| InChIKey | GVXBKNQLDIAPFC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 121.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-5-nitroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5-nitroindazole?
The IUPAC name of 1-benzyl-5-nitroindazole (CID 139048397) is 1-benzyl-5-nitroindazole.
What is the SMILES notation for 1-benzyl-5-nitroindazole?
The canonical SMILES for 1-benzyl-5-nitroindazole is O=[N+]([O-])c1ccc2c(cnn2Cc2ccccc2)c1.O=[N+]([O-])c1ccc2c(cnn2Cc2ccccc2)c1.
What is the InChIKey of 1-benzyl-5-nitroindazole?
The InChIKey is GVXBKNQLDIAPFC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H11N3O2/c2*18-17(19)13-6-7-14-12(8-13)9-15-16(14)10-11-4-2-1-3-5-11/h2*1-9H,10H2.
What are the key properties of 1-benzyl-5-nitroindazole?
1-benzyl-5-nitroindazole has a molecular weight of 506.52 g/mol, XLogP of 5.99, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5-nitroindazole is sourced from PubChem (CID 139048397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).