About CID 139048397
CID 139048397 (PubChem CID 139048397) has the molecular formula C28H22N6O4
and a molecular weight of 506.50 g/mol. Its IUPAC name is 1-benzyl-5-nitroindazole.
Molecular Properties
| Compound Name | CID 139048397 |
| PubChem CID | 139048397 |
| Molecular Formula | C28H22N6O4 |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 1-benzyl-5-nitroindazole |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)[N+](=O)[O-])C=N2.C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)[N+](=O)[O-])C=N2 |
| InChI | InChI=1S/2C14H11N3O2/c2*18-17(19)13-6-7-14-12(8-13)9-15-16(14)10-11-4-2-1-3-5-11/h2*1-9H,10H2 |
| InChIKey | GVXBKNQLDIAPFC-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 127.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | 325 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 139048397 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139048397?
The IUPAC name of CID 139048397 (CID 139048397) is 1-benzyl-5-nitroindazole.
What is the SMILES notation for CID 139048397?
The canonical SMILES for CID 139048397 is C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)[N+](=O)[O-])C=N2.C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)[N+](=O)[O-])C=N2.
What is the InChIKey of CID 139048397?
The InChIKey is GVXBKNQLDIAPFC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H11N3O2/c2*18-17(19)13-6-7-14-12(8-13)9-15-16(14)10-11-4-2-1-3-5-11/h2*1-9H,10H2.
What are the key properties of CID 139048397?
CID 139048397 has a molecular weight of 506.50 g/mol, XLogP of not available, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139048397 is sourced from PubChem (CID 139048397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).