C22H38O8 — CID 160640431
4-O-(4,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate;methane (PubChem CID 160640431) has the molecular formula C22H38O8 and a molecular weight of 430.54 g/mol. Its IUPAC name is 4-O-(4,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate;methane.
| Compound Name | 4-O-(4,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate;methane |
|---|---|
| PubChem CID | 160640431 |
| Molecular Formula | C22H38O8 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 4-O-(4,5-dimethyl-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 1-O-[2-(2-methylbutanoyloxy)ethyl] butanedioate;methane |
| SMILES | C.C.CCC(C)C(=O)OCCOC(=O)CCC(=O)OC1(C)CCC2CC1(C)OC2=O |
| InChI | InChI=1S/C20H30O8.2CH4/c1-5-13(2)17(23)26-11-10-25-15(21)6-7-16(22)27-19(3)9-8-14-12-20(19,4)28-18(14)24;;/h13-14H,5-12H2,1-4H3;2*1H4 |
| InChIKey | RJCHFMOXENSAED-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|