C16H28O4 — CID 142609752
2-propanoyloxyethyl 2-(3,3-dimethylcyclohexyl)propanoate (PubChem CID 142609752) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-propanoyloxyethyl 2-(3,3-dimethylcyclohexyl)propanoate.
| Compound Name | 2-propanoyloxyethyl 2-(3,3-dimethylcyclohexyl)propanoate |
|---|---|
| PubChem CID | 142609752 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-propanoyloxyethyl 2-(3,3-dimethylcyclohexyl)propanoate |
| SMILES | CCC(=O)OCCOC(=O)C(C)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C16H28O4/c1-5-14(17)19-9-10-20-15(18)12(2)13-7-6-8-16(3,4)11-13/h12-13H,5-11H2,1-4H3 |
| InChIKey | NXXLZUSSCXHTOE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|